C19H21N3O4 — CID 110276799
(4E)-4-[hydroxy-(1,3,5-trimethylpyrazol-4-yl)methylidene]-5-(4-methoxyphenyl)-1-methylpyrrolidine-2,3-dione (PubChem CID 110276799) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is (4E)-4-[hydroxy-(1,3,5-trimethylpyrazol-4-yl)methylidene]-5-(4-methoxyphenyl)-1-methylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy-(1,3,5-trimethylpyrazol-4-yl)methylidene]-5-(4-methoxyphenyl)-1-methylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 110276799 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | (4E)-4-[hydroxy-(1,3,5-trimethylpyrazol-4-yl)methylidene]-5-(4-methoxyphenyl)-1-methylpyrrolidine-2,3-dione |
| SMILES | COc1ccc(C2/C(=C(\O)c3c(C)nn(C)c3C)C(=O)C(=O)N2C)cc1 |
| InChI | InChI=1S/C19H21N3O4/c1-10-14(11(2)22(4)20-10)17(23)15-16(21(3)19(25)18(15)24)12-6-8-13(26-5)9-7-12/h6-9,16,23H,1-5H3/b17-15+ |
| InChIKey | JMSYEPLLZHMEQY-BMRADRMJSA-N |
| XLogP | 2.10 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|