C23H23N5O3S2 — CID 110278786
N'-[1-(1,3-benzoxazol-2-yl)ethyl]-N-[5-[(2-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]butanediamide (PubChem CID 110278786) has the molecular formula C23H23N5O3S2 and a molecular weight of 481.60 g/mol. Its IUPAC name is N'-[1-(1,3-benzoxazol-2-yl)ethyl]-N-[5-[(2-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]butanediamide.
| Compound Name | N'-[1-(1,3-benzoxazol-2-yl)ethyl]-N-[5-[(2-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]butanediamide |
|---|---|
| PubChem CID | 110278786 |
| Molecular Formula | C23H23N5O3S2 |
| Molecular Weight | 481.60 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | N'-[1-(1,3-benzoxazol-2-yl)ethyl]-N-[5-[(2-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]butanediamide |
| SMILES | Cc1ccccc1CSc1nnc(NC(=O)CCC(=O)NC(C)c2nc3ccccc3o2)s1 |
| InChI | InChI=1S/C23H23N5O3S2/c1-14-7-3-4-8-16(14)13-32-23-28-27-22(33-23)26-20(30)12-11-19(29)24-15(2)21-25-17-9-5-6-10-18(17)31-21/h3-10,15H,11-13H2,1-2H3,(H,24,29)(H,26,27,30) |
| InChIKey | PXEQGHLRHMOZQZ-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.60 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|