C23H24BrNO4 — CID 110279752
5-[(2-bromophenoxy)methyl]-N-[2-hydroxy-2-(4-propan-2-ylphenyl)ethyl]furan-2-carboxamide (PubChem CID 110279752) has the molecular formula C23H24BrNO4 and a molecular weight of 458.35 g/mol. Its IUPAC name is 5-[(2-bromophenoxy)methyl]-N-[2-hydroxy-2-(4-propan-2-ylphenyl)ethyl]furan-2-carboxamide.
| Compound Name | 5-[(2-bromophenoxy)methyl]-N-[2-hydroxy-2-(4-propan-2-ylphenyl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 110279752 |
| Molecular Formula | C23H24BrNO4 |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 5-[(2-bromophenoxy)methyl]-N-[2-hydroxy-2-(4-propan-2-ylphenyl)ethyl]furan-2-carboxamide |
| SMILES | CC(C)c1ccc(C(O)CNC(=O)c2ccc(COc3ccccc3Br)o2)cc1 |
| InChI | InChI=1S/C23H24BrNO4/c1-15(2)16-7-9-17(10-8-16)20(26)13-25-23(27)22-12-11-18(29-22)14-28-21-6-4-3-5-19(21)24/h3-12,15,20,26H,13-14H2,1-2H3,(H,25,27) |
| InChIKey | BFSOZIMRHLHSAA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |