C12H11NO5 — CID 110282089
4-(1,3-benzodioxol-5-yl)-2-oxopyrrolidine-3-carboxylic acid (PubChem CID 110282089) has the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-2-oxopyrrolidine-3-carboxylic acid.
| Compound Name | 4-(1,3-benzodioxol-5-yl)-2-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 110282089 |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-2-oxopyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1C(=O)NCC1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H11NO5/c14-11-10(12(15)16)7(4-13-11)6-1-2-8-9(3-6)18-5-17-8/h1-3,7,10H,4-5H2,(H,13,14)(H,15,16) |
| InChIKey | CVSWGSDJEKVBCW-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|