C13H9NOS2 — CID 110282316
1-(5-thieno[3,2-b]pyridin-7-ylthiophen-2-yl)ethanone (PubChem CID 110282316) has the molecular formula C13H9NOS2 and a molecular weight of 259.36 g/mol. Its IUPAC name is 1-(5-thieno[3,2-b]pyridin-7-ylthiophen-2-yl)ethanone.
| Compound Name | 1-(5-thieno[3,2-b]pyridin-7-ylthiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 110282316 |
| Molecular Formula | C13H9NOS2 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | 1-(5-thieno[3,2-b]pyridin-7-ylthiophen-2-yl)ethanone |
| SMILES | CC(=O)c1ccc(-c2ccnc3ccsc23)s1 |
| InChI | InChI=1S/C13H9NOS2/c1-8(15)11-2-3-12(17-11)9-4-6-14-10-5-7-16-13(9)10/h2-7H,1H3 |
| InChIKey | SUPJFFXDHHEURW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |