C14H20ClN3O2 — CID 110282432
2-(3-oxopiperazin-2-yl)-N-(1-phenylethyl)acetamide;hydrochloride (PubChem CID 110282432) has the molecular formula C14H20ClN3O2 and a molecular weight of 297.79 g/mol. Its IUPAC name is 2-(3-oxopiperazin-2-yl)-N-(1-phenylethyl)acetamide;hydrochloride.
| Compound Name | 2-(3-oxopiperazin-2-yl)-N-(1-phenylethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 110282432 |
| Molecular Formula | C14H20ClN3O2 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2-(3-oxopiperazin-2-yl)-N-(1-phenylethyl)acetamide;hydrochloride |
| SMILES | CC(NC(=O)CC1NCCNC1=O)c1ccccc1.Cl |
| InChI | InChI=1S/C14H19N3O2.ClH/c1-10(11-5-3-2-4-6-11)17-13(18)9-12-14(19)16-8-7-15-12;/h2-6,10,12,15H,7-9H2,1H3,(H,16,19)(H,17,18);1H |
| InChIKey | MWLYCIZXMQCNRF-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |