C14H26ClN3O3 — CID 110282902
2-[3-oxo-4-(oxolan-2-ylmethyl)piperazin-2-yl]-N-propan-2-ylacetamide;hydrochloride (PubChem CID 110282902) has the molecular formula C14H26ClN3O3 and a molecular weight of 319.83 g/mol. Its IUPAC name is 2-[3-oxo-4-(oxolan-2-ylmethyl)piperazin-2-yl]-N-propan-2-ylacetamide;hydrochloride.
| Compound Name | 2-[3-oxo-4-(oxolan-2-ylmethyl)piperazin-2-yl]-N-propan-2-ylacetamide;hydrochloride |
|---|---|
| PubChem CID | 110282902 |
| Molecular Formula | C14H26ClN3O3 |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.17 |
| IUPAC Name | 2-[3-oxo-4-(oxolan-2-ylmethyl)piperazin-2-yl]-N-propan-2-ylacetamide;hydrochloride |
| SMILES | CC(C)NC(=O)CC1NCCN(CC2CCCO2)C1=O.Cl |
| InChI | InChI=1S/C14H25N3O3.ClH/c1-10(2)16-13(18)8-12-14(19)17(6-5-15-12)9-11-4-3-7-20-11;/h10-12,15H,3-9H2,1-2H3,(H,16,18);1H |
| InChIKey | UYJUMUZTUMWCOC-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |