C35H72O4SiSn — CID 11028902
tert-butyl-[[(1S,2S,3S)-2-[(2S)-2-(methoxymethoxy)-2-tributylstannylethyl]-2-methyl-6-methylidene-3-[(2-methylpropan-2-yl)oxy]cyclohexyl]methoxy]-dimethylsilane (PubChem CID 11028902) has the molecular formula C35H72O4SiSn and a molecular weight of 703.75 g/mol. Its IUPAC name is tert-butyl-[[(1S,2S,3S)-2-[(2S)-2-(methoxymethoxy)-2-tributylstannylethyl]-2-methyl-6-methylidene-3-[(2-methylpropan-2-yl)oxy]cyclohexyl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,2S,3S)-2-[(2S)-2-(methoxymethoxy)-2-tributylstannylethyl]-2-methyl-6-methylidene-3-[(2-methylpropan-2-yl)oxy]cyclohexyl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11028902 |
| Molecular Formula | C35H72O4SiSn |
| Molecular Weight | 703.75 g/mol |
| Exact Mass | 704.42 |
| IUPAC Name | tert-butyl-[[(1S,2S,3S)-2-[(2S)-2-(methoxymethoxy)-2-tributylstannylethyl]-2-methyl-6-methylidene-3-[(2-methylpropan-2-yl)oxy]cyclohexyl]methoxy]-dimethylsilane |
| SMILES | C=C1CC[C@H](OC(C)(C)C)[C@@](C)(C[C@@H](OCOC)[Sn](CCCC)(CCCC)CCCC)[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H45O4Si.3C4H9.Sn/c1-18-12-13-20(27-21(2,3)4)23(8,14-15-25-17-24-9)19(18)16-26-28(10,11)22(5,6)7;3*1-3-4-2;/h15,19-20H,1,12-14,16-17H2,2-11H3;3*1,3-4H2,2H3;/t19-,20-,23-;;;;/m0..../s1 |
| InChIKey | TYJXBBBBGJLBON-HEDIHIAKSA-N |
| XLogP | 10.93 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.75 |
| LogP ≤ 5 | 10.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|