C31H64O3SiSn — CID 11227445
tert-butyl-[[(1S,2S)-2-[(2R)-2-(methoxymethoxy)-2-tributylstannylethyl]-2-methyl-6-methylidenecyclohexyl]methoxy]-dimethylsilane (PubChem CID 11227445) has the molecular formula C31H64O3SiSn and a molecular weight of 631.65 g/mol. Its IUPAC name is tert-butyl-[[(1S,2S)-2-[(2R)-2-(methoxymethoxy)-2-tributylstannylethyl]-2-methyl-6-methylidenecyclohexyl]methoxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(1S,2S)-2-[(2R)-2-(methoxymethoxy)-2-tributylstannylethyl]-2-methyl-6-methylidenecyclohexyl]methoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11227445 |
| Molecular Formula | C31H64O3SiSn |
| Molecular Weight | 631.65 g/mol |
| Exact Mass | 632.36 |
| IUPAC Name | tert-butyl-[[(1S,2S)-2-[(2R)-2-(methoxymethoxy)-2-tributylstannylethyl]-2-methyl-6-methylidenecyclohexyl]methoxy]-dimethylsilane |
| SMILES | C=C1CCC[C@@](C)(C[C@H](OCOC)[Sn](CCCC)(CCCC)CCCC)[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H37O3Si.3C4H9.Sn/c1-16-10-9-11-19(5,12-13-21-15-20-6)17(16)14-22-23(7,8)18(2,3)4;3*1-3-4-2;/h13,17H,1,9-12,14-15H2,2-8H3;3*1,3-4H2,2H3;/t17-,19-;;;;/m0..../s1 |
| InChIKey | UHOIAEARNXVTAE-LHQOOKHHSA-N |
| XLogP | 10.14 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.65 |
| LogP ≤ 5 | 10.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|