C27H54O2Si2 — CID 13353557
tert-butyl-[1-[1-[tert-butyl(dimethyl)silyl]ethenoxy]-4-(2,2-dimethyl-6-methylidenecyclohexyl)butoxy]-dimethylsilane (PubChem CID 13353557) has the molecular formula C27H54O2Si2 and a molecular weight of 466.90 g/mol. Its IUPAC name is tert-butyl-[1-[1-[tert-butyl(dimethyl)silyl]ethenoxy]-4-(2,2-dimethyl-6-methylidenecyclohexyl)butoxy]-dimethylsilane.
| Compound Name | tert-butyl-[1-[1-[tert-butyl(dimethyl)silyl]ethenoxy]-4-(2,2-dimethyl-6-methylidenecyclohexyl)butoxy]-dimethylsilane |
|---|---|
| PubChem CID | 13353557 |
| Molecular Formula | C27H54O2Si2 |
| Molecular Weight | 466.90 g/mol |
| Exact Mass | 466.37 |
| IUPAC Name | tert-butyl-[1-[1-[tert-butyl(dimethyl)silyl]ethenoxy]-4-(2,2-dimethyl-6-methylidenecyclohexyl)butoxy]-dimethylsilane |
| SMILES | C=C1CCCC(C)(C)C1CCCC(OC(=C)[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H54O2Si2/c1-21-17-16-20-27(9,10)23(21)18-15-19-24(29-31(13,14)26(6,7)8)28-22(2)30(11,12)25(3,4)5/h23-24H,1-2,15-20H2,3-14H3 |
| InChIKey | VDENGJLKYNZRPK-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.90 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|