C52H64N2O8 — CID 11029245
bis[4-[(6R,7R,7aS)-3,3-dimethyl-5-oxo-6-propan-2-yl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-7-yl]naphthalen-1-yl] decanedioate (PubChem CID 11029245) has the molecular formula C52H64N2O8 and a molecular weight of 845.09 g/mol. Its IUPAC name is bis[4-[(6R,7R,7aS)-3,3-dimethyl-5-oxo-6-propan-2-yl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-7-yl]naphthalen-1-yl] decanedioate.
| Compound Name | bis[4-[(6R,7R,7aS)-3,3-dimethyl-5-oxo-6-propan-2-yl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-7-yl]naphthalen-1-yl] decanedioate |
|---|---|
| PubChem CID | 11029245 |
| Molecular Formula | C52H64N2O8 |
| Molecular Weight | 845.09 g/mol |
| Exact Mass | 844.47 |
| IUPAC Name | bis[4-[(6R,7R,7aS)-3,3-dimethyl-5-oxo-6-propan-2-yl-1,6,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-7-yl]naphthalen-1-yl] decanedioate |
| SMILES | CC(C)[C@H]1C(=O)N2[C@H](COC2(C)C)[C@H]1c1ccc(OC(=O)CCCCCCCCC(=O)Oc2ccc([C@H]3[C@@H](C(C)C)C(=O)N4[C@@H]3COC4(C)C)c3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C52H64N2O8/c1-31(2)45-47(39-29-59-51(5,6)53(39)49(45)57)37-25-27-41(35-21-17-15-19-33(35)37)61-43(55)23-13-11-9-10-12-14-24-44(56)62-42-28-26-38(34-20-16-18-22-36(34)42)48-40-30-60-52(7,8)54(40)50(58)46(48)32(3)4/h15-22,25-28,31-32,39-40,45-48H,9-14,23-24,29-30H2,1-8H3/t39-,40-,45-,46-,47-,48-/m1/s1 |
| InChIKey | VMMXGXQACJWLBW-XEBYSKHXSA-N |
| XLogP | 10.29 |
| TPSA | 111.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.09 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|