C20H16ClFN2O — CID 110296356
N-(3-chlorophenyl)-2-(4-fluorophenyl)-3-pyridin-2-ylpropanamide (PubChem CID 110296356) has the molecular formula C20H16ClFN2O and a molecular weight of 354.81 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(4-fluorophenyl)-3-pyridin-2-ylpropanamide.
| Compound Name | N-(3-chlorophenyl)-2-(4-fluorophenyl)-3-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 110296356 |
| Molecular Formula | C20H16ClFN2O |
| Molecular Weight | 354.81 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | N-(3-chlorophenyl)-2-(4-fluorophenyl)-3-pyridin-2-ylpropanamide |
| SMILES | O=C(Nc1cccc(Cl)c1)C(Cc1ccccn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H16ClFN2O/c21-15-4-3-6-18(12-15)24-20(25)19(13-17-5-1-2-11-23-17)14-7-9-16(22)10-8-14/h1-12,19H,13H2,(H,24,25) |
| InChIKey | OHOCOLSILZBQEW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.81 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |