C21H28FN3O — CID 110301478
N-[2-(diethylamino)propyl]-2-(4-fluorophenyl)-3-pyridin-2-ylpropanamide (PubChem CID 110301478) has the molecular formula C21H28FN3O and a molecular weight of 357.47 g/mol. Its IUPAC name is N-[2-(diethylamino)propyl]-2-(4-fluorophenyl)-3-pyridin-2-ylpropanamide.
| Compound Name | N-[2-(diethylamino)propyl]-2-(4-fluorophenyl)-3-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 110301478 |
| Molecular Formula | C21H28FN3O |
| Molecular Weight | 357.47 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | N-[2-(diethylamino)propyl]-2-(4-fluorophenyl)-3-pyridin-2-ylpropanamide |
| SMILES | CCN(CC)C(C)CNC(=O)C(Cc1ccccn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C21H28FN3O/c1-4-25(5-2)16(3)15-24-21(26)20(14-19-8-6-7-13-23-19)17-9-11-18(22)12-10-17/h6-13,16,20H,4-5,14-15H2,1-3H3,(H,24,26) |
| InChIKey | GFXJQPGONMQNKE-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.47 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |