C20H27FN2OS — CID 110301477
N-[2-(diethylamino)propyl]-2-(4-fluorophenyl)-3-thiophen-2-ylpropanamide (PubChem CID 110301477) has the molecular formula C20H27FN2OS and a molecular weight of 362.51 g/mol. Its IUPAC name is N-[2-(diethylamino)propyl]-2-(4-fluorophenyl)-3-thiophen-2-ylpropanamide.
| Compound Name | N-[2-(diethylamino)propyl]-2-(4-fluorophenyl)-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 110301477 |
| Molecular Formula | C20H27FN2OS |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | N-[2-(diethylamino)propyl]-2-(4-fluorophenyl)-3-thiophen-2-ylpropanamide |
| SMILES | CCN(CC)C(C)CNC(=O)C(Cc1cccs1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H27FN2OS/c1-4-23(5-2)15(3)14-22-20(24)19(13-18-7-6-12-25-18)16-8-10-17(21)11-9-16/h6-12,15,19H,4-5,13-14H2,1-3H3,(H,22,24) |
| InChIKey | BTNZHKGYBZWONW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |