C24H24FNO3S2 — CID 19877423
2-[1-(4-fluorophenyl)-1-oxo-3-thiophen-2-ylpropan-2-yl]-4-methyl-3-oxo-N-(thiophen-2-ylmethyl)pentanamide (PubChem CID 19877423) has the molecular formula C24H24FNO3S2 and a molecular weight of 457.59 g/mol. Its IUPAC name is 2-[1-(4-fluorophenyl)-1-oxo-3-thiophen-2-ylpropan-2-yl]-4-methyl-3-oxo-N-(thiophen-2-ylmethyl)pentanamide.
| Compound Name | 2-[1-(4-fluorophenyl)-1-oxo-3-thiophen-2-ylpropan-2-yl]-4-methyl-3-oxo-N-(thiophen-2-ylmethyl)pentanamide |
|---|---|
| PubChem CID | 19877423 |
| Molecular Formula | C24H24FNO3S2 |
| Molecular Weight | 457.59 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 2-[1-(4-fluorophenyl)-1-oxo-3-thiophen-2-ylpropan-2-yl]-4-methyl-3-oxo-N-(thiophen-2-ylmethyl)pentanamide |
| SMILES | CC(C)C(=O)C(C(=O)NCc1cccs1)C(Cc1cccs1)C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H24FNO3S2/c1-15(2)22(27)21(24(29)26-14-19-6-4-12-31-19)20(13-18-5-3-11-30-18)23(28)16-7-9-17(25)10-8-16/h3-12,15,20-21H,13-14H2,1-2H3,(H,26,29) |
| InChIKey | ZGKYUJOJZFCGIL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|