C22H20FNO3S — CID 112773422
2-[4-(4-fluorobenzoyl)phenoxy]-N-(2-thiophen-2-ylethyl)propanamide (PubChem CID 112773422) has the molecular formula C22H20FNO3S and a molecular weight of 397.47 g/mol. Its IUPAC name is 2-[4-(4-fluorobenzoyl)phenoxy]-N-(2-thiophen-2-ylethyl)propanamide.
| Compound Name | 2-[4-(4-fluorobenzoyl)phenoxy]-N-(2-thiophen-2-ylethyl)propanamide |
|---|---|
| PubChem CID | 112773422 |
| Molecular Formula | C22H20FNO3S |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 2-[4-(4-fluorobenzoyl)phenoxy]-N-(2-thiophen-2-ylethyl)propanamide |
| SMILES | CC(Oc1ccc(C(=O)c2ccc(F)cc2)cc1)C(=O)NCCc1cccs1 |
| InChI | InChI=1S/C22H20FNO3S/c1-15(22(26)24-13-12-20-3-2-14-28-20)27-19-10-6-17(7-11-19)21(25)16-4-8-18(23)9-5-16/h2-11,14-15H,12-13H2,1H3,(H,24,26) |
| InChIKey | ROJQWSPPSJBSKO-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |