C19H25FN2OS — CID 110303228
N-[2-(dimethylamino)-2-methylpropyl]-2-(4-fluorophenyl)-3-thiophen-2-ylpropanamide (PubChem CID 110303228) has the molecular formula C19H25FN2OS and a molecular weight of 348.49 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-methylpropyl]-2-(4-fluorophenyl)-3-thiophen-2-ylpropanamide.
| Compound Name | N-[2-(dimethylamino)-2-methylpropyl]-2-(4-fluorophenyl)-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 110303228 |
| Molecular Formula | C19H25FN2OS |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | N-[2-(dimethylamino)-2-methylpropyl]-2-(4-fluorophenyl)-3-thiophen-2-ylpropanamide |
| SMILES | CN(C)C(C)(C)CNC(=O)C(Cc1cccs1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H25FN2OS/c1-19(2,22(3)4)13-21-18(23)17(12-16-6-5-11-24-16)14-7-9-15(20)10-8-14/h5-11,17H,12-13H2,1-4H3,(H,21,23) |
| InChIKey | HOUDOLWTGQTLQG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |