C20H21F2NO3S — CID 110296558
N-(1,1-dioxothiolan-3-yl)-2,3-bis(4-fluorophenyl)-N-methylpropanamide (PubChem CID 110296558) has the molecular formula C20H21F2NO3S and a molecular weight of 393.46 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2,3-bis(4-fluorophenyl)-N-methylpropanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2,3-bis(4-fluorophenyl)-N-methylpropanamide |
|---|---|
| PubChem CID | 110296558 |
| Molecular Formula | C20H21F2NO3S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2,3-bis(4-fluorophenyl)-N-methylpropanamide |
| SMILES | CN(C(=O)C(Cc1ccc(F)cc1)c1ccc(F)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C20H21F2NO3S/c1-23(18-10-11-27(25,26)13-18)20(24)19(15-4-8-17(22)9-5-15)12-14-2-6-16(21)7-3-14/h2-9,18-19H,10-13H2,1H3 |
| InChIKey | ZSICXQKIPWWRID-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |