C16H23FN2O3S — CID 109025084
N-(1,1-dioxothiolan-3-yl)-3-[2-(4-fluorophenyl)ethylamino]-N-methylpropanamide (PubChem CID 109025084) has the molecular formula C16H23FN2O3S and a molecular weight of 342.44 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-3-[2-(4-fluorophenyl)ethylamino]-N-methylpropanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-3-[2-(4-fluorophenyl)ethylamino]-N-methylpropanamide |
|---|---|
| PubChem CID | 109025084 |
| Molecular Formula | C16H23FN2O3S |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-3-[2-(4-fluorophenyl)ethylamino]-N-methylpropanamide |
| SMILES | CN(C(=O)CCNCCc1ccc(F)cc1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C16H23FN2O3S/c1-19(15-8-11-23(21,22)12-15)16(20)7-10-18-9-6-13-2-4-14(17)5-3-13/h2-5,15,18H,6-12H2,1H3 |
| InChIKey | GWYOACLOTKOSCH-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|