C18H14ClFN2O3 — CID 110299190
2-chloro-N-(2,4-dimethoxyphenyl)-7-fluoroquinoline-3-carboxamide (PubChem CID 110299190) has the molecular formula C18H14ClFN2O3 and a molecular weight of 360.77 g/mol. Its IUPAC name is 2-chloro-N-(2,4-dimethoxyphenyl)-7-fluoroquinoline-3-carboxamide.
| Compound Name | 2-chloro-N-(2,4-dimethoxyphenyl)-7-fluoroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 110299190 |
| Molecular Formula | C18H14ClFN2O3 |
| Molecular Weight | 360.77 g/mol |
| Exact Mass | 360.07 |
| IUPAC Name | 2-chloro-N-(2,4-dimethoxyphenyl)-7-fluoroquinoline-3-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc3ccc(F)cc3nc2Cl)c(OC)c1 |
| InChI | InChI=1S/C18H14ClFN2O3/c1-24-12-5-6-14(16(9-12)25-2)22-18(23)13-7-10-3-4-11(20)8-15(10)21-17(13)19/h3-9H,1-2H3,(H,22,23) |
| InChIKey | MITDVYZMWRMGEV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.77 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|