C19H16ClFN2O3 — CID 110299153
2-chloro-7-fluoro-N-[2-(4-methoxyphenoxy)ethyl]quinoline-3-carboxamide (PubChem CID 110299153) has the molecular formula C19H16ClFN2O3 and a molecular weight of 374.80 g/mol. Its IUPAC name is 2-chloro-7-fluoro-N-[2-(4-methoxyphenoxy)ethyl]quinoline-3-carboxamide.
| Compound Name | 2-chloro-7-fluoro-N-[2-(4-methoxyphenoxy)ethyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 110299153 |
| Molecular Formula | C19H16ClFN2O3 |
| Molecular Weight | 374.80 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | 2-chloro-7-fluoro-N-[2-(4-methoxyphenoxy)ethyl]quinoline-3-carboxamide |
| SMILES | COc1ccc(OCCNC(=O)c2cc3ccc(F)cc3nc2Cl)cc1 |
| InChI | InChI=1S/C19H16ClFN2O3/c1-25-14-4-6-15(7-5-14)26-9-8-22-19(24)16-10-12-2-3-13(21)11-17(12)23-18(16)20/h2-7,10-11H,8-9H2,1H3,(H,22,24) |
| InChIKey | KOPADGFQSGANKQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.80 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|