C20H19FN2O4 — CID 113212396
1-acetyl-5-fluoro-N-[2-(4-methoxyphenoxy)ethyl]indole-3-carboxamide (PubChem CID 113212396) has the molecular formula C20H19FN2O4 and a molecular weight of 370.38 g/mol. Its IUPAC name is 1-acetyl-5-fluoro-N-[2-(4-methoxyphenoxy)ethyl]indole-3-carboxamide.
| Compound Name | 1-acetyl-5-fluoro-N-[2-(4-methoxyphenoxy)ethyl]indole-3-carboxamide |
|---|---|
| PubChem CID | 113212396 |
| Molecular Formula | C20H19FN2O4 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 1-acetyl-5-fluoro-N-[2-(4-methoxyphenoxy)ethyl]indole-3-carboxamide |
| SMILES | COc1ccc(OCCNC(=O)c2cn(C(C)=O)c3ccc(F)cc23)cc1 |
| InChI | InChI=1S/C20H19FN2O4/c1-13(24)23-12-18(17-11-14(21)3-8-19(17)23)20(25)22-9-10-27-16-6-4-15(26-2)5-7-16/h3-8,11-12H,9-10H2,1-2H3,(H,22,25) |
| InChIKey | KVWQOSLKMCKIJG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|