C19H23NO6 — CID 8934968
2,4,5-trimethoxy-N-[2-(4-methoxyphenoxy)ethyl]benzamide (PubChem CID 8934968) has the molecular formula C19H23NO6 and a molecular weight of 361.39 g/mol. Its IUPAC name is 2,4,5-trimethoxy-N-[2-(4-methoxyphenoxy)ethyl]benzamide.
| Compound Name | 2,4,5-trimethoxy-N-[2-(4-methoxyphenoxy)ethyl]benzamide |
|---|---|
| PubChem CID | 8934968 |
| Molecular Formula | C19H23NO6 |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | 2,4,5-trimethoxy-N-[2-(4-methoxyphenoxy)ethyl]benzamide |
| SMILES | COc1ccc(OCCNC(=O)c2cc(OC)c(OC)cc2OC)cc1 |
| InChI | InChI=1S/C19H23NO6/c1-22-13-5-7-14(8-6-13)26-10-9-20-19(21)15-11-17(24-3)18(25-4)12-16(15)23-2/h5-8,11-12H,9-10H2,1-4H3,(H,20,21) |
| InChIKey | YHKSFLGDYZQPBQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|