C14H18N4O3 — CID 82545915
5-amino-N-[2-(4-methoxyphenoxy)ethyl]-1-methylpyrazole-4-carboxamide (PubChem CID 82545915) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 5-amino-N-[2-(4-methoxyphenoxy)ethyl]-1-methylpyrazole-4-carboxamide.
| Compound Name | 5-amino-N-[2-(4-methoxyphenoxy)ethyl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 82545915 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 5-amino-N-[2-(4-methoxyphenoxy)ethyl]-1-methylpyrazole-4-carboxamide |
| SMILES | COc1ccc(OCCNC(=O)c2cnn(C)c2N)cc1 |
| InChI | InChI=1S/C14H18N4O3/c1-18-13(15)12(9-17-18)14(19)16-7-8-21-11-5-3-10(20-2)4-6-11/h3-6,9H,7-8,15H2,1-2H3,(H,16,19) |
| InChIKey | SWRGZVJSBAPXII-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|