C9H16N4O3 — CID 110485264
5-amino-N-(2,2-dimethoxyethyl)-1-methylpyrazole-4-carboxamide (PubChem CID 110485264) has the molecular formula C9H16N4O3 and a molecular weight of 228.25 g/mol. Its IUPAC name is 5-amino-N-(2,2-dimethoxyethyl)-1-methylpyrazole-4-carboxamide.
| Compound Name | 5-amino-N-(2,2-dimethoxyethyl)-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 110485264 |
| Molecular Formula | C9H16N4O3 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 5-amino-N-(2,2-dimethoxyethyl)-1-methylpyrazole-4-carboxamide |
| SMILES | COC(CNC(=O)c1cnn(C)c1N)OC |
| InChI | InChI=1S/C9H16N4O3/c1-13-8(10)6(4-12-13)9(14)11-5-7(15-2)16-3/h4,7H,5,10H2,1-3H3,(H,11,14) |
| InChIKey | DRDMVRKZWNMAJC-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|