C9H16N4O3S — CID 115330667
5-amino-1-methyl-N-(3-methylsulfonylpropyl)pyrazole-4-carboxamide (PubChem CID 115330667) has the molecular formula C9H16N4O3S and a molecular weight of 260.32 g/mol. Its IUPAC name is 5-amino-1-methyl-N-(3-methylsulfonylpropyl)pyrazole-4-carboxamide.
| Compound Name | 5-amino-1-methyl-N-(3-methylsulfonylpropyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 115330667 |
| Molecular Formula | C9H16N4O3S |
| Molecular Weight | 260.32 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 5-amino-1-methyl-N-(3-methylsulfonylpropyl)pyrazole-4-carboxamide |
| SMILES | Cn1ncc(C(=O)NCCCS(C)(=O)=O)c1N |
| InChI | InChI=1S/C9H16N4O3S/c1-13-8(10)7(6-12-13)9(14)11-4-3-5-17(2,15)16/h6H,3-5,10H2,1-2H3,(H,11,14) |
| InChIKey | OQWDXKLJURAEFT-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.32 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|