C11H21N5O — CID 82546931
5-amino-N-[2-(diethylamino)ethyl]-1-methylpyrazole-4-carboxamide (PubChem CID 82546931) has the molecular formula C11H21N5O and a molecular weight of 239.32 g/mol. Its IUPAC name is 5-amino-N-[2-(diethylamino)ethyl]-1-methylpyrazole-4-carboxamide.
| Compound Name | 5-amino-N-[2-(diethylamino)ethyl]-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 82546931 |
| Molecular Formula | C11H21N5O |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.17 |
| IUPAC Name | 5-amino-N-[2-(diethylamino)ethyl]-1-methylpyrazole-4-carboxamide |
| SMILES | CCN(CC)CCNC(=O)c1cnn(C)c1N |
| InChI | InChI=1S/C11H21N5O/c1-4-16(5-2)7-6-13-11(17)9-8-14-15(3)10(9)12/h8H,4-7,12H2,1-3H3,(H,13,17) |
| InChIKey | KUADTXVVKNGBCN-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 76.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |