C15H14N3O5- — CID 7189406
3-[2-(4-methoxyphenoxy)ethylcarbamoyl]pyrazine-2-carboxylate (PubChem CID 7189406) has the molecular formula C15H14N3O5- and a molecular weight of 316.29 g/mol. Its IUPAC name is 3-[2-(4-methoxyphenoxy)ethylcarbamoyl]pyrazine-2-carboxylate.
| Compound Name | 3-[2-(4-methoxyphenoxy)ethylcarbamoyl]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 7189406 |
| Molecular Formula | C15H14N3O5- |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 3-[2-(4-methoxyphenoxy)ethylcarbamoyl]pyrazine-2-carboxylate |
| SMILES | COc1ccc(OCCNC(=O)c2nccnc2C(=O)[O-])cc1 |
| InChI | InChI=1S/C15H15N3O5/c1-22-10-2-4-11(5-3-10)23-9-8-18-14(19)12-13(15(20)21)17-7-6-16-12/h2-7H,8-9H2,1H3,(H,18,19)(H,20,21)/p-1 |
| InChIKey | KYNPQIWQYPKDAD-UHFFFAOYSA-M |
| XLogP | -0.34 |
| TPSA | 113.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|