C19H15ClF2N2O2 — CID 110307324
2-chloro-7-fluoro-N-[3-(4-fluorophenoxy)propyl]quinoline-3-carboxamide (PubChem CID 110307324) has the molecular formula C19H15ClF2N2O2 and a molecular weight of 376.79 g/mol. Its IUPAC name is 2-chloro-7-fluoro-N-[3-(4-fluorophenoxy)propyl]quinoline-3-carboxamide.
| Compound Name | 2-chloro-7-fluoro-N-[3-(4-fluorophenoxy)propyl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 110307324 |
| Molecular Formula | C19H15ClF2N2O2 |
| Molecular Weight | 376.79 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 2-chloro-7-fluoro-N-[3-(4-fluorophenoxy)propyl]quinoline-3-carboxamide |
| SMILES | O=C(NCCCOc1ccc(F)cc1)c1cc2ccc(F)cc2nc1Cl |
| InChI | InChI=1S/C19H15ClF2N2O2/c20-18-16(10-12-2-3-14(22)11-17(12)24-18)19(25)23-8-1-9-26-15-6-4-13(21)5-7-15/h2-7,10-11H,1,8-9H2,(H,23,25) |
| InChIKey | VRMMAUTVASKEKF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.79 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|