C18H21ClFN3O — CID 110303168
2-chloro-7-fluoro-N-(2-methyl-2-pyrrolidin-1-ylpropyl)quinoline-3-carboxamide (PubChem CID 110303168) has the molecular formula C18H21ClFN3O and a molecular weight of 349.84 g/mol. Its IUPAC name is 2-chloro-7-fluoro-N-(2-methyl-2-pyrrolidin-1-ylpropyl)quinoline-3-carboxamide.
| Compound Name | 2-chloro-7-fluoro-N-(2-methyl-2-pyrrolidin-1-ylpropyl)quinoline-3-carboxamide |
|---|---|
| PubChem CID | 110303168 |
| Molecular Formula | C18H21ClFN3O |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 2-chloro-7-fluoro-N-(2-methyl-2-pyrrolidin-1-ylpropyl)quinoline-3-carboxamide |
| SMILES | CC(C)(CNC(=O)c1cc2ccc(F)cc2nc1Cl)N1CCCC1 |
| InChI | InChI=1S/C18H21ClFN3O/c1-18(2,23-7-3-4-8-23)11-21-17(24)14-9-12-5-6-13(20)10-15(12)22-16(14)19/h5-6,9-10H,3-4,7-8,11H2,1-2H3,(H,21,24) |
| InChIKey | DCWSKODKCFEXQJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|