C22H25ClN2O — CID 110301107
1-(4-benzylpiperazin-1-yl)-2-(4-chlorophenyl)-2-cyclopropylethanone (PubChem CID 110301107) has the molecular formula C22H25ClN2O and a molecular weight of 368.91 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-1-yl)-2-(4-chlorophenyl)-2-cyclopropylethanone.
| Compound Name | 1-(4-benzylpiperazin-1-yl)-2-(4-chlorophenyl)-2-cyclopropylethanone |
|---|---|
| PubChem CID | 110301107 |
| Molecular Formula | C22H25ClN2O |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 1-(4-benzylpiperazin-1-yl)-2-(4-chlorophenyl)-2-cyclopropylethanone |
| SMILES | O=C(C(c1ccc(Cl)cc1)C1CC1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H25ClN2O/c23-20-10-8-19(9-11-20)21(18-6-7-18)22(26)25-14-12-24(13-15-25)16-17-4-2-1-3-5-17/h1-5,8-11,18,21H,6-7,12-16H2 |
| InChIKey | SZOISPOVLIKJSS-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |