C20H24ClN3O — CID 7928563
(2S)-1-(4-benzylpiperazin-1-yl)-2-(4-chloroanilino)propan-1-one (PubChem CID 7928563) has the molecular formula C20H24ClN3O and a molecular weight of 357.89 g/mol. Its IUPAC name is (2S)-1-(4-benzylpiperazin-1-yl)-2-(4-chloroanilino)propan-1-one.
| Compound Name | (2S)-1-(4-benzylpiperazin-1-yl)-2-(4-chloroanilino)propan-1-one |
|---|---|
| PubChem CID | 7928563 |
| Molecular Formula | C20H24ClN3O |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | (2S)-1-(4-benzylpiperazin-1-yl)-2-(4-chloroanilino)propan-1-one |
| SMILES | C[C@H](Nc1ccc(Cl)cc1)C(=O)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H24ClN3O/c1-16(22-19-9-7-18(21)8-10-19)20(25)24-13-11-23(12-14-24)15-17-5-3-2-4-6-17/h2-10,16,22H,11-15H2,1H3/t16-/m0/s1 |
| InChIKey | AONMVVQDXWKCCV-INIZCTEOSA-N |
| XLogP | 3.48 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |