C22H24ClN3O — CID 110301948
2-chloro-N-[2-(dimethylamino)-2-phenylethyl]-6,8-dimethylquinoline-3-carboxamide (PubChem CID 110301948) has the molecular formula C22H24ClN3O and a molecular weight of 381.91 g/mol. Its IUPAC name is 2-chloro-N-[2-(dimethylamino)-2-phenylethyl]-6,8-dimethylquinoline-3-carboxamide.
| Compound Name | 2-chloro-N-[2-(dimethylamino)-2-phenylethyl]-6,8-dimethylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 110301948 |
| Molecular Formula | C22H24ClN3O |
| Molecular Weight | 381.91 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-chloro-N-[2-(dimethylamino)-2-phenylethyl]-6,8-dimethylquinoline-3-carboxamide |
| SMILES | Cc1cc(C)c2nc(Cl)c(C(=O)NCC(c3ccccc3)N(C)C)cc2c1 |
| InChI | InChI=1S/C22H24ClN3O/c1-14-10-15(2)20-17(11-14)12-18(21(23)25-20)22(27)24-13-19(26(3)4)16-8-6-5-7-9-16/h5-12,19H,13H2,1-4H3,(H,24,27) |
| InChIKey | IMQYBVUMWORVRL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.91 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|