C20H23FN2O3 — CID 110302511
4-(4-fluorophenyl)-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-4-oxobutanamide (PubChem CID 110302511) has the molecular formula C20H23FN2O3 and a molecular weight of 358.41 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-4-oxobutanamide.
| Compound Name | 4-(4-fluorophenyl)-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 110302511 |
| Molecular Formula | C20H23FN2O3 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 4-(4-fluorophenyl)-N-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-4-oxobutanamide |
| SMILES | O=C(CCC(=O)c1ccc(F)cc1)NCC(c1ccco1)N1CCCC1 |
| InChI | InChI=1S/C20H23FN2O3/c21-16-7-5-15(6-8-16)18(24)9-10-20(25)22-14-17(19-4-3-13-26-19)23-11-1-2-12-23/h3-8,13,17H,1-2,9-12,14H2,(H,22,25) |
| InChIKey | DEFXXSKIBQEOKE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |