C13H9ClF3N3O3S — CID 110303473
N-[4-[(6-chloro-3-pyridinyl)sulfonylamino]phenyl]-2,2,2-trifluoroacetamide (PubChem CID 110303473) has the molecular formula C13H9ClF3N3O3S and a molecular weight of 379.75 g/mol. Its IUPAC name is N-[4-[(6-chloro-3-pyridinyl)sulfonylamino]phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-[(6-chloro-3-pyridinyl)sulfonylamino]phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 110303473 |
| Molecular Formula | C13H9ClF3N3O3S |
| Molecular Weight | 379.75 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | N-[4-[(6-chloro-3-pyridinyl)sulfonylamino]phenyl]-2,2,2-trifluoroacetamide |
| SMILES | O=C(Nc1ccc(NS(=O)(=O)c2ccc(Cl)nc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C13H9ClF3N3O3S/c14-11-6-5-10(7-18-11)24(22,23)20-9-3-1-8(2-4-9)19-12(21)13(15,16)17/h1-7,20H,(H,19,21) |
| InChIKey | ICHDHWGPLCAHQL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.75 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|