C22H29N3O2S — CID 110304311
(E)-N-[2-[4-(dimethylamino)phenyl]-2-morpholin-4-ylethyl]-2-methyl-3-thiophen-2-ylprop-2-enamide (PubChem CID 110304311) has the molecular formula C22H29N3O2S and a molecular weight of 399.56 g/mol. Its IUPAC name is (E)-N-[2-[4-(dimethylamino)phenyl]-2-morpholin-4-ylethyl]-2-methyl-3-thiophen-2-ylprop-2-enamide.
| Compound Name | (E)-N-[2-[4-(dimethylamino)phenyl]-2-morpholin-4-ylethyl]-2-methyl-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 110304311 |
| Molecular Formula | C22H29N3O2S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | (E)-N-[2-[4-(dimethylamino)phenyl]-2-morpholin-4-ylethyl]-2-methyl-3-thiophen-2-ylprop-2-enamide |
| SMILES | C/C(=C\c1cccs1)C(=O)NCC(c1ccc(N(C)C)cc1)N1CCOCC1 |
| InChI | InChI=1S/C22H29N3O2S/c1-17(15-20-5-4-14-28-20)22(26)23-16-21(25-10-12-27-13-11-25)18-6-8-19(9-7-18)24(2)3/h4-9,14-15,21H,10-13,16H2,1-3H3,(H,23,26)/b17-15+ |
| InChIKey | NUOMLIQYBBJNIM-BMRADRMJSA-N |
| XLogP | 3.41 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|