C12H12Cl2N4O4S — CID 110304375
(2S)-2-[(5,6-dichloro-3-pyridinyl)sulfonylamino]-N-(5-methyl-1,2-oxazol-3-yl)propanamide (PubChem CID 110304375) has the molecular formula C12H12Cl2N4O4S and a molecular weight of 379.23 g/mol. Its IUPAC name is (2S)-2-[(5,6-dichloro-3-pyridinyl)sulfonylamino]-N-(5-methyl-1,2-oxazol-3-yl)propanamide.
| Compound Name | (2S)-2-[(5,6-dichloro-3-pyridinyl)sulfonylamino]-N-(5-methyl-1,2-oxazol-3-yl)propanamide |
|---|---|
| PubChem CID | 110304375 |
| Molecular Formula | C12H12Cl2N4O4S |
| Molecular Weight | 379.23 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | (2S)-2-[(5,6-dichloro-3-pyridinyl)sulfonylamino]-N-(5-methyl-1,2-oxazol-3-yl)propanamide |
| SMILES | Cc1cc(NC(=O)[C@H](C)NS(=O)(=O)c2cnc(Cl)c(Cl)c2)no1 |
| InChI | InChI=1S/C12H12Cl2N4O4S/c1-6-3-10(17-22-6)16-12(19)7(2)18-23(20,21)8-4-9(13)11(14)15-5-8/h3-5,7,18H,1-2H3,(H,16,17,19)/t7-/m0/s1 |
| InChIKey | TXBABFZXJJWPAT-ZETCQYMHSA-N |
| XLogP | 1.99 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|