C18H22FN3O3 — CID 110304419
5-(4-fluorophenyl)-N-[(2S)-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxopropan-2-yl]pentanamide (PubChem CID 110304419) has the molecular formula C18H22FN3O3 and a molecular weight of 347.39 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-N-[(2S)-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxopropan-2-yl]pentanamide.
| Compound Name | 5-(4-fluorophenyl)-N-[(2S)-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxopropan-2-yl]pentanamide |
|---|---|
| PubChem CID | 110304419 |
| Molecular Formula | C18H22FN3O3 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 5-(4-fluorophenyl)-N-[(2S)-1-[(5-methyl-1,2-oxazol-3-yl)amino]-1-oxopropan-2-yl]pentanamide |
| SMILES | Cc1cc(NC(=O)[C@H](C)NC(=O)CCCCc2ccc(F)cc2)no1 |
| InChI | InChI=1S/C18H22FN3O3/c1-12-11-16(22-25-12)21-18(24)13(2)20-17(23)6-4-3-5-14-7-9-15(19)10-8-14/h7-11,13H,3-6H2,1-2H3,(H,20,23)(H,21,22,24)/t13-/m0/s1 |
| InChIKey | QMPPOOYBWGYRDF-ZDUSSCGKSA-N |
| XLogP | 2.98 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|