C17H32N2O4S — CID 110304785
5-piperidin-1-ylsulfonyl-1-(2,5,5-trimethylmorpholin-4-yl)pentan-1-one (PubChem CID 110304785) has the molecular formula C17H32N2O4S and a molecular weight of 360.52 g/mol. Its IUPAC name is 5-piperidin-1-ylsulfonyl-1-(2,5,5-trimethylmorpholin-4-yl)pentan-1-one.
| Compound Name | 5-piperidin-1-ylsulfonyl-1-(2,5,5-trimethylmorpholin-4-yl)pentan-1-one |
|---|---|
| PubChem CID | 110304785 |
| Molecular Formula | C17H32N2O4S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 5-piperidin-1-ylsulfonyl-1-(2,5,5-trimethylmorpholin-4-yl)pentan-1-one |
| SMILES | CC1CN(C(=O)CCCCS(=O)(=O)N2CCCCC2)C(C)(C)CO1 |
| InChI | InChI=1S/C17H32N2O4S/c1-15-13-19(17(2,3)14-23-15)16(20)9-5-8-12-24(21,22)18-10-6-4-7-11-18/h15H,4-14H2,1-3H3 |
| InChIKey | IRUQRUFGEVGRGY-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|