C20H30N2O3S — CID 110414609
1-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-5-piperidin-1-ylsulfonylpentan-1-one (PubChem CID 110414609) has the molecular formula C20H30N2O3S and a molecular weight of 378.54 g/mol. Its IUPAC name is 1-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-5-piperidin-1-ylsulfonylpentan-1-one.
| Compound Name | 1-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-5-piperidin-1-ylsulfonylpentan-1-one |
|---|---|
| PubChem CID | 110414609 |
| Molecular Formula | C20H30N2O3S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | 1-(3-methyl-3,4-dihydro-2H-quinolin-1-yl)-5-piperidin-1-ylsulfonylpentan-1-one |
| SMILES | CC1Cc2ccccc2N(C(=O)CCCCS(=O)(=O)N2CCCCC2)C1 |
| InChI | InChI=1S/C20H30N2O3S/c1-17-15-18-9-3-4-10-19(18)22(16-17)20(23)11-5-8-14-26(24,25)21-12-6-2-7-13-21/h3-4,9-10,17H,2,5-8,11-16H2,1H3 |
| InChIKey | ZMOPNXJTFNVSRQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|