C18H26N2O3S — CID 6472541
(1-butylsulfonylpiperidin-3-yl)-(2,3-dihydroindol-1-yl)methanone (PubChem CID 6472541) has the molecular formula C18H26N2O3S and a molecular weight of 350.48 g/mol. Its IUPAC name is (1-butylsulfonylpiperidin-3-yl)-(2,3-dihydroindol-1-yl)methanone.
| Compound Name | (1-butylsulfonylpiperidin-3-yl)-(2,3-dihydroindol-1-yl)methanone |
|---|---|
| PubChem CID | 6472541 |
| Molecular Formula | C18H26N2O3S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | (1-butylsulfonylpiperidin-3-yl)-(2,3-dihydroindol-1-yl)methanone |
| SMILES | CCCCS(=O)(=O)N1CCCC(C(=O)N2CCc3ccccc32)C1 |
| InChI | InChI=1S/C18H26N2O3S/c1-2-3-13-24(22,23)19-11-6-8-16(14-19)18(21)20-12-10-15-7-4-5-9-17(15)20/h4-5,7,9,16H,2-3,6,8,10-14H2,1H3 |
| InChIKey | XDAIBHJUKOTINH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |