C20H25N3O3 — CID 110304954
(2S)-N-(5-methyl-1,2-oxazol-3-yl)-1-(5-phenylpentanoyl)pyrrolidine-2-carboxamide (PubChem CID 110304954) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is (2S)-N-(5-methyl-1,2-oxazol-3-yl)-1-(5-phenylpentanoyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-(5-methyl-1,2-oxazol-3-yl)-1-(5-phenylpentanoyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110304954 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | (2S)-N-(5-methyl-1,2-oxazol-3-yl)-1-(5-phenylpentanoyl)pyrrolidine-2-carboxamide |
| SMILES | Cc1cc(NC(=O)[C@@H]2CCCN2C(=O)CCCCc2ccccc2)no1 |
| InChI | InChI=1S/C20H25N3O3/c1-15-14-18(22-26-15)21-20(25)17-11-7-13-23(17)19(24)12-6-5-10-16-8-3-2-4-9-16/h2-4,8-9,14,17H,5-7,10-13H2,1H3,(H,21,22,25)/t17-/m0/s1 |
| InChIKey | OEDPBTZLQYPIOW-KRWDZBQOSA-N |
| XLogP | 3.33 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|