C20H24FN3O3 — CID 110304952
(2S)-1-[5-(4-fluorophenyl)pentanoyl]-N-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2-carboxamide (PubChem CID 110304952) has the molecular formula C20H24FN3O3 and a molecular weight of 373.43 g/mol. Its IUPAC name is (2S)-1-[5-(4-fluorophenyl)pentanoyl]-N-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S)-1-[5-(4-fluorophenyl)pentanoyl]-N-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110304952 |
| Molecular Formula | C20H24FN3O3 |
| Molecular Weight | 373.43 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | (2S)-1-[5-(4-fluorophenyl)pentanoyl]-N-(5-methyl-1,2-oxazol-3-yl)pyrrolidine-2-carboxamide |
| SMILES | Cc1cc(NC(=O)[C@@H]2CCCN2C(=O)CCCCc2ccc(F)cc2)no1 |
| InChI | InChI=1S/C20H24FN3O3/c1-14-13-18(23-27-14)22-20(26)17-6-4-12-24(17)19(25)7-3-2-5-15-8-10-16(21)11-9-15/h8-11,13,17H,2-7,12H2,1H3,(H,22,23,26)/t17-/m0/s1 |
| InChIKey | MIVRBWVZKCHKNO-KRWDZBQOSA-N |
| XLogP | 3.46 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|