C20H27ClN2O4 — CID 110305687
4-(4-chlorophenyl)-N-[(2S)-4-methyl-1-morpholin-4-yl-1-oxopentan-2-yl]-4-oxobutanamide (PubChem CID 110305687) has the molecular formula C20H27ClN2O4 and a molecular weight of 394.90 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[(2S)-4-methyl-1-morpholin-4-yl-1-oxopentan-2-yl]-4-oxobutanamide.
| Compound Name | 4-(4-chlorophenyl)-N-[(2S)-4-methyl-1-morpholin-4-yl-1-oxopentan-2-yl]-4-oxobutanamide |
|---|---|
| PubChem CID | 110305687 |
| Molecular Formula | C20H27ClN2O4 |
| Molecular Weight | 394.90 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[(2S)-4-methyl-1-morpholin-4-yl-1-oxopentan-2-yl]-4-oxobutanamide |
| SMILES | CC(C)C[C@H](NC(=O)CCC(=O)c1ccc(Cl)cc1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C20H27ClN2O4/c1-14(2)13-17(20(26)23-9-11-27-12-10-23)22-19(25)8-7-18(24)15-3-5-16(21)6-4-15/h3-6,14,17H,7-13H2,1-2H3,(H,22,25)/t17-/m0/s1 |
| InChIKey | BPQLNFCDTXRFDW-KRWDZBQOSA-N |
| XLogP | 2.69 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.90 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |