C18H26ClN3O3 — CID 110305706
1-[(3-chlorophenyl)methyl]-3-[(2S)-4-methyl-1-morpholin-4-yl-1-oxopentan-2-yl]urea (PubChem CID 110305706) has the molecular formula C18H26ClN3O3 and a molecular weight of 367.88 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-[(2S)-4-methyl-1-morpholin-4-yl-1-oxopentan-2-yl]urea.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-[(2S)-4-methyl-1-morpholin-4-yl-1-oxopentan-2-yl]urea |
|---|---|
| PubChem CID | 110305706 |
| Molecular Formula | C18H26ClN3O3 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-[(2S)-4-methyl-1-morpholin-4-yl-1-oxopentan-2-yl]urea |
| SMILES | CC(C)C[C@H](NC(=O)NCc1cccc(Cl)c1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C18H26ClN3O3/c1-13(2)10-16(17(23)22-6-8-25-9-7-22)21-18(24)20-12-14-4-3-5-15(19)11-14/h3-5,11,13,16H,6-10,12H2,1-2H3,(H2,20,21,24)/t16-/m0/s1 |
| InChIKey | LQJLRWOSEOMJIP-INIZCTEOSA-N |
| XLogP | 2.41 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |