C15H18ClN5O2 — CID 138015942
1-[(3-chlorophenyl)methyl]-3-(5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]oxazepin-3-ylmethyl)urea (PubChem CID 138015942) has the molecular formula C15H18ClN5O2 and a molecular weight of 335.80 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-3-(5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]oxazepin-3-ylmethyl)urea.
| Compound Name | 1-[(3-chlorophenyl)methyl]-3-(5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]oxazepin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 138015942 |
| Molecular Formula | C15H18ClN5O2 |
| Molecular Weight | 335.80 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-3-(5,6,8,9-tetrahydro-[1,2,4]triazolo[4,3-d][1,4]oxazepin-3-ylmethyl)urea |
| SMILES | O=C(NCc1cccc(Cl)c1)NCc1nnc2n1CCOCC2 |
| InChI | InChI=1S/C15H18ClN5O2/c16-12-3-1-2-11(8-12)9-17-15(22)18-10-14-20-19-13-4-6-23-7-5-21(13)14/h1-3,8H,4-7,9-10H2,(H2,17,18,22) |
| InChIKey | SLKXCEDVFGRXCO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.80 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |