C16H17ClN4O — CID 97077113
cis-(1R,2S)-2-(3-chlorophenyl)-N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)cyclopropane-1-carboxamide (PubChem CID 97077113) has the molecular formula C16H17ClN4O and a molecular weight of 316.79 g/mol. Its IUPAC name is cis-(1R,2S)-2-(3-chlorophenyl)-N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)cyclopropane-1-carboxamide.
| Compound Name | cis-(1R,2S)-2-(3-chlorophenyl)-N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 97077113 |
| Molecular Formula | C16H17ClN4O |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | cis-(1R,2S)-2-(3-chlorophenyl)-N-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)cyclopropane-1-carboxamide |
| SMILES | O=C(NCc1nnc2n1CCC2)[C@@H]1C[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H17ClN4O/c17-11-4-1-3-10(7-11)12-8-13(12)16(22)18-9-15-20-19-14-5-2-6-21(14)15/h1,3-4,7,12-13H,2,5-6,8-9H2,(H,18,22)/t12-,13-/m1/s1 |
| InChIKey | UMADCLJFXVKPFA-CHWSQXEVSA-N |
| XLogP | 2.30 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |