C22H24N2O3 — CID 110306183
(E)-2-methyl-N-[(1S)-2-morpholin-4-yl-2-oxo-1-phenylethyl]-3-phenylprop-2-enamide (PubChem CID 110306183) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is (E)-2-methyl-N-[(1S)-2-morpholin-4-yl-2-oxo-1-phenylethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-2-methyl-N-[(1S)-2-morpholin-4-yl-2-oxo-1-phenylethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 110306183 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (E)-2-methyl-N-[(1S)-2-morpholin-4-yl-2-oxo-1-phenylethyl]-3-phenylprop-2-enamide |
| SMILES | C/C(=C\c1ccccc1)C(=O)N[C@H](C(=O)N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O3/c1-17(16-18-8-4-2-5-9-18)21(25)23-20(19-10-6-3-7-11-19)22(26)24-12-14-27-15-13-24/h2-11,16,20H,12-15H2,1H3,(H,23,25)/b17-16+/t20-/m0/s1 |
| InChIKey | PZMINTINSUDRHH-NIQRWSHPSA-N |
| XLogP | 2.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|