C19H28N2O3 — CID 97227101
(2S)-1-morpholin-4-yl-2-[[(1S)-1-(oxan-4-yl)ethyl]amino]-2-phenylethanone (PubChem CID 97227101) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is (2S)-1-morpholin-4-yl-2-[[(1S)-1-(oxan-4-yl)ethyl]amino]-2-phenylethanone.
| Compound Name | (2S)-1-morpholin-4-yl-2-[[(1S)-1-(oxan-4-yl)ethyl]amino]-2-phenylethanone |
|---|---|
| PubChem CID | 97227101 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | (2S)-1-morpholin-4-yl-2-[[(1S)-1-(oxan-4-yl)ethyl]amino]-2-phenylethanone |
| SMILES | C[C@H](N[C@H](C(=O)N1CCOCC1)c1ccccc1)C1CCOCC1 |
| InChI | InChI=1S/C19H28N2O3/c1-15(16-7-11-23-12-8-16)20-18(17-5-3-2-4-6-17)19(22)21-9-13-24-14-10-21/h2-6,15-16,18,20H,7-14H2,1H3/t15-,18-/m0/s1 |
| InChIKey | GSHUBCCFPFNGGA-YJBOKZPZSA-N |
| XLogP | 1.99 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |