C15H23FN2O5S2 — CID 110306666
2-(4-fluorophenoxy)-N-(2-piperidin-1-ylsulfonylethyl)ethanesulfonamide (PubChem CID 110306666) has the molecular formula C15H23FN2O5S2 and a molecular weight of 394.49 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N-(2-piperidin-1-ylsulfonylethyl)ethanesulfonamide.
| Compound Name | 2-(4-fluorophenoxy)-N-(2-piperidin-1-ylsulfonylethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 110306666 |
| Molecular Formula | C15H23FN2O5S2 |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 2-(4-fluorophenoxy)-N-(2-piperidin-1-ylsulfonylethyl)ethanesulfonamide |
| SMILES | O=S(=O)(CCOc1ccc(F)cc1)NCCS(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C15H23FN2O5S2/c16-14-4-6-15(7-5-14)23-11-13-24(19,20)17-8-12-25(21,22)18-9-2-1-3-10-18/h4-7,17H,1-3,8-13H2 |
| InChIKey | YNOFNBPNFXOZEG-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |